C15H22O3 — CID 11579691
7'a-(prop-2-enoxymethyl)spiro[1,3-dioxolane-2,5'-2,4,6,7-tetrahydro-1H-indene] (PubChem CID 11579691) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 7'a-(prop-2-enoxymethyl)spiro[1,3-dioxolane-2,5'-2,4,6,7-tetrahydro-1H-indene].
| Compound Name | 7'a-(prop-2-enoxymethyl)spiro[1,3-dioxolane-2,5'-2,4,6,7-tetrahydro-1H-indene] |
|---|---|
| PubChem CID | 11579691 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 7'a-(prop-2-enoxymethyl)spiro[1,3-dioxolane-2,5'-2,4,6,7-tetrahydro-1H-indene] |
| SMILES | C=CCOCC12CCC=C1CC1(CC2)OCCO1 |
| InChI | InChI=1S/C15H22O3/c1-2-8-16-12-14-5-3-4-13(14)11-15(7-6-14)17-9-10-18-15/h2,4H,1,3,5-12H2 |
| InChIKey | JAJXRQIPKQDMBU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|