C12H7BrF2N2O2 — CID 115797103
(4-bromo-2,6-difluorophenyl)-(3-methoxypyrazin-2-yl)methanone (PubChem CID 115797103) has the molecular formula C12H7BrF2N2O2 and a molecular weight of 329.10 g/mol. Its IUPAC name is (4-bromo-2,6-difluorophenyl)-(3-methoxypyrazin-2-yl)methanone.
| Compound Name | (4-bromo-2,6-difluorophenyl)-(3-methoxypyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 115797103 |
| Molecular Formula | C12H7BrF2N2O2 |
| Molecular Weight | 329.10 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | (4-bromo-2,6-difluorophenyl)-(3-methoxypyrazin-2-yl)methanone |
| SMILES | COc1nccnc1C(=O)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C12H7BrF2N2O2/c1-19-12-10(16-2-3-17-12)11(18)9-7(14)4-6(13)5-8(9)15/h2-5H,1H3 |
| InChIKey | WFNOZTFISGMMOJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.10 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |