C13H24O2 — CID 115797718
oxan-4-yl-(2,2,3,3-tetramethylcyclopropyl)methanol (PubChem CID 115797718) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is oxan-4-yl-(2,2,3,3-tetramethylcyclopropyl)methanol.
| Compound Name | oxan-4-yl-(2,2,3,3-tetramethylcyclopropyl)methanol |
|---|---|
| PubChem CID | 115797718 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | oxan-4-yl-(2,2,3,3-tetramethylcyclopropyl)methanol |
| SMILES | CC1(C)C(C(O)C2CCOCC2)C1(C)C |
| InChI | InChI=1S/C13H24O2/c1-12(2)11(13(12,3)4)10(14)9-5-7-15-8-6-9/h9-11,14H,5-8H2,1-4H3 |
| InChIKey | YOIPTPGAKKMZMC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |