C19H20N2 — CID 115798284
1-(2,5-dimethylphenyl)-N-methyl-1-quinolin-3-ylmethanamine (PubChem CID 115798284) has the molecular formula C19H20N2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-N-methyl-1-quinolin-3-ylmethanamine.
| Compound Name | 1-(2,5-dimethylphenyl)-N-methyl-1-quinolin-3-ylmethanamine |
|---|---|
| PubChem CID | 115798284 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-N-methyl-1-quinolin-3-ylmethanamine |
| SMILES | CNC(c1cnc2ccccc2c1)c1cc(C)ccc1C |
| InChI | InChI=1S/C19H20N2/c1-13-8-9-14(2)17(10-13)19(20-3)16-11-15-6-4-5-7-18(15)21-12-16/h4-12,19-20H,1-3H3 |
| InChIKey | YIRFJUHLOPFAOL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |