C16H11F3N2 — CID 115798580
quinolin-3-yl-(2,4,6-trifluorophenyl)methanamine (PubChem CID 115798580) has the molecular formula C16H11F3N2 and a molecular weight of 288.27 g/mol. Its IUPAC name is quinolin-3-yl-(2,4,6-trifluorophenyl)methanamine.
| Compound Name | quinolin-3-yl-(2,4,6-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 115798580 |
| Molecular Formula | C16H11F3N2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | quinolin-3-yl-(2,4,6-trifluorophenyl)methanamine |
| SMILES | NC(c1cnc2ccccc2c1)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C16H11F3N2/c17-11-6-12(18)15(13(19)7-11)16(20)10-5-9-3-1-2-4-14(9)21-8-10/h1-8,16H,20H2 |
| InChIKey | JLXDMNHRWUPVDS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |