C14H20N2 — CID 115799190
N-[3-bicyclo[3.1.0]hexanyl(pyridin-3-yl)methyl]ethanamine (PubChem CID 115799190) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is N-[3-bicyclo[3.1.0]hexanyl(pyridin-3-yl)methyl]ethanamine.
| Compound Name | N-[3-bicyclo[3.1.0]hexanyl(pyridin-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 115799190 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | N-[3-bicyclo[3.1.0]hexanyl(pyridin-3-yl)methyl]ethanamine |
| SMILES | CCNC(c1cccnc1)C1CC2CC2C1 |
| InChI | InChI=1S/C14H20N2/c1-2-16-14(10-4-3-5-15-9-10)13-7-11-6-12(11)8-13/h3-5,9,11-14,16H,2,6-8H2,1H3 |
| InChIKey | AAOQTSFDXSYWDC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |