C17H24O3 — CID 11579980
[(3aR,4R,7R)-1,4-dimethyl-2-oxo-7-prop-1-en-2-yl-3,3a,5,6,7,8-hexahydroazulen-4-yl] acetate (PubChem CID 11579980) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is [(3aR,4R,7R)-1,4-dimethyl-2-oxo-7-prop-1-en-2-yl-3,3a,5,6,7,8-hexahydroazulen-4-yl] acetate.
| Compound Name | [(3aR,4R,7R)-1,4-dimethyl-2-oxo-7-prop-1-en-2-yl-3,3a,5,6,7,8-hexahydroazulen-4-yl] acetate |
|---|---|
| PubChem CID | 11579980 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | [(3aR,4R,7R)-1,4-dimethyl-2-oxo-7-prop-1-en-2-yl-3,3a,5,6,7,8-hexahydroazulen-4-yl] acetate |
| SMILES | C=C(C)[C@@H]1CC[C@@](C)(OC(C)=O)[C@@H]2CC(=O)C(C)=C2C1 |
| InChI | InChI=1S/C17H24O3/c1-10(2)13-6-7-17(5,20-12(4)18)15-9-16(19)11(3)14(15)8-13/h13,15H,1,6-9H2,2-5H3/t13-,15-,17-/m1/s1 |
| InChIKey | KAMNHZXDGOUPID-FRFSOERESA-N |
| XLogP | 3.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|