C16H21FO2 — CID 115800308
4-cyclopentyl-1-(2-fluoro-3-methoxyphenyl)butan-2-one (PubChem CID 115800308) has the molecular formula C16H21FO2 and a molecular weight of 264.34 g/mol. Its IUPAC name is 4-cyclopentyl-1-(2-fluoro-3-methoxyphenyl)butan-2-one.
| Compound Name | 4-cyclopentyl-1-(2-fluoro-3-methoxyphenyl)butan-2-one |
|---|---|
| PubChem CID | 115800308 |
| Molecular Formula | C16H21FO2 |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 4-cyclopentyl-1-(2-fluoro-3-methoxyphenyl)butan-2-one |
| SMILES | COc1cccc(CC(=O)CCC2CCCC2)c1F |
| InChI | InChI=1S/C16H21FO2/c1-19-15-8-4-7-13(16(15)17)11-14(18)10-9-12-5-2-3-6-12/h4,7-8,12H,2-3,5-6,9-11H2,1H3 |
| InChIKey | JBPPVMJWQAUXJT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |