C7H11IN2S — CID 11580040
4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine;hydroiodide (PubChem CID 11580040) has the molecular formula C7H11IN2S and a molecular weight of 282.15 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine;hydroiodide.
| Compound Name | 4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 11580040 |
| Molecular Formula | C7H11IN2S |
| Molecular Weight | 282.15 g/mol |
| Exact Mass | 281.97 |
| IUPAC Name | 4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine;hydroiodide |
| SMILES | I.Nc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C7H10N2S.HI/c8-7-9-5-3-1-2-4-6(5)10-7;/h1-4H2,(H2,8,9);1H |
| InChIKey | SRIBOJGMWSVQMR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.15 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|