C13H18ClNO2S — CID 115801368
1-(2-chlorophenyl)-1-(1,1-dioxothian-2-yl)-N-methylmethanamine (PubChem CID 115801368) has the molecular formula C13H18ClNO2S and a molecular weight of 287.81 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-1-(1,1-dioxothian-2-yl)-N-methylmethanamine.
| Compound Name | 1-(2-chlorophenyl)-1-(1,1-dioxothian-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 115801368 |
| Molecular Formula | C13H18ClNO2S |
| Molecular Weight | 287.81 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 1-(2-chlorophenyl)-1-(1,1-dioxothian-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1ccccc1Cl)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C13H18ClNO2S/c1-15-13(10-6-2-3-7-11(10)14)12-8-4-5-9-18(12,16)17/h2-3,6-7,12-13,15H,4-5,8-9H2,1H3 |
| InChIKey | PMDLGHXUGMSAAT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.81 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |