About N-[(2-chlorophenyl)-(2,4,5-trimethyloxolan-3-yl)methyl]propan-1-amine
N-[(2-chlorophenyl)-(2,4,5-trimethyloxolan-3-yl)methyl]propan-1-amine (PubChem CID 115801423) has the molecular formula C17H26ClNO
and a molecular weight of 295.85 g/mol. Its IUPAC name is N-[(2-chlorophenyl)-(2,4,5-trimethyloxolan-3-yl)methyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[(2-chlorophenyl)-(2,4,5-trimethyloxolan-3-yl)methyl]propan-1-amine |
| PubChem CID | 115801423 |
| Molecular Formula | C17H26ClNO |
| Molecular Weight | 295.85 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-[(2-chlorophenyl)-(2,4,5-trimethyloxolan-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccccc1Cl)C1C(C)OC(C)C1C |
| InChI | InChI=1S/C17H26ClNO/c1-5-10-19-17(14-8-6-7-9-15(14)18)16-11(2)12(3)20-13(16)4/h6-9,11-13,16-17,19H,5,10H2,1-4H3 |
| InChIKey | DUPFBFYSISDEET-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.85 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2-chlorophenyl)-(2,4,5-trimethyloxolan-3-yl)methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-chlorophenyl)-(2,4,5-trimethyloxolan-3-yl)methyl]propan-1-amine?
The IUPAC name of N-[(2-chlorophenyl)-(2,4,5-trimethyloxolan-3-yl)methyl]propan-1-amine (CID 115801423) is N-[(2-chlorophenyl)-(2,4,5-trimethyloxolan-3-yl)methyl]propan-1-amine.
What is the SMILES notation for N-[(2-chlorophenyl)-(2,4,5-trimethyloxolan-3-yl)methyl]propan-1-amine?
The canonical SMILES for N-[(2-chlorophenyl)-(2,4,5-trimethyloxolan-3-yl)methyl]propan-1-amine is CCCNC(c1ccccc1Cl)C1C(C)OC(C)C1C.
What is the InChIKey of N-[(2-chlorophenyl)-(2,4,5-trimethyloxolan-3-yl)methyl]propan-1-amine?
The InChIKey is DUPFBFYSISDEET-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26ClNO/c1-5-10-19-17(14-8-6-7-9-15(14)18)16-11(2)12(3)20-13(16)4/h6-9,11-13,16-17,19H,5,10H2,1-4H3.
What are the key properties of N-[(2-chlorophenyl)-(2,4,5-trimethyloxolan-3-yl)methyl]propan-1-amine?
N-[(2-chlorophenyl)-(2,4,5-trimethyloxolan-3-yl)methyl]propan-1-amine has a molecular weight of 295.85 g/mol, XLogP of 4.44, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-chlorophenyl)-(2,4,5-trimethyloxolan-3-yl)methyl]propan-1-amine is sourced from PubChem (CID 115801423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).