C15H22Cl2O — CID 115801993
1-(2,5-dichlorophenyl)-3-ethylheptan-2-ol (PubChem CID 115801993) has the molecular formula C15H22Cl2O and a molecular weight of 289.25 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-ethylheptan-2-ol.
| Compound Name | 1-(2,5-dichlorophenyl)-3-ethylheptan-2-ol |
|---|---|
| PubChem CID | 115801993 |
| Molecular Formula | C15H22Cl2O |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-ethylheptan-2-ol |
| SMILES | CCCCC(CC)C(O)Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H22Cl2O/c1-3-5-6-11(4-2)15(18)10-12-9-13(16)7-8-14(12)17/h7-9,11,15,18H,3-6,10H2,1-2H3 |
| InChIKey | WFUJCPFQMRPRSG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |