About 1,10-diazabicyclo[8.6.6]docosa-5,13,19-triyne
1,10-diazabicyclo[8.6.6]docosa-5,13,19-triyne (PubChem CID 11580230) has the molecular formula C20H28N2
and a molecular weight of 296.46 g/mol. Its IUPAC name is 1,10-diazabicyclo[8.6.6]docosa-5,13,19-triyne.
Molecular Properties
| Compound Name | 1,10-diazabicyclo[8.6.6]docosa-5,13,19-triyne |
| PubChem CID | 11580230 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 1,10-diazabicyclo[8.6.6]docosa-5,13,19-triyne |
| SMILES | C1#CCCCN2CCC#CCCN(CCC#CCC2)CCC1 |
| InChI | InChI=1S/C20H28N2/c1-2-4-10-16-22-19-13-7-5-11-17-21(15-9-3-1)18-12-6-8-14-20-22/h3-4,9-20H2 |
| InChIKey | OXNJEKLXDSWAOQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,10-diazabicyclo[8.6.6]docosa-5,13,19-triyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,10-diazabicyclo[8.6.6]docosa-5,13,19-triyne?
The IUPAC name of 1,10-diazabicyclo[8.6.6]docosa-5,13,19-triyne (CID 11580230) is 1,10-diazabicyclo[8.6.6]docosa-5,13,19-triyne.
What is the SMILES notation for 1,10-diazabicyclo[8.6.6]docosa-5,13,19-triyne?
The canonical SMILES for 1,10-diazabicyclo[8.6.6]docosa-5,13,19-triyne is C1#CCCCN2CCC#CCCN(CCC#CCC2)CCC1.
What is the InChIKey of 1,10-diazabicyclo[8.6.6]docosa-5,13,19-triyne?
The InChIKey is OXNJEKLXDSWAOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N2/c1-2-4-10-16-22-19-13-7-5-11-17-21(15-9-3-1)18-12-6-8-14-20-22/h3-4,9-20H2.
What are the key properties of 1,10-diazabicyclo[8.6.6]docosa-5,13,19-triyne?
1,10-diazabicyclo[8.6.6]docosa-5,13,19-triyne has a molecular weight of 296.46 g/mol, XLogP of 2.75, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,10-diazabicyclo[8.6.6]docosa-5,13,19-triyne is sourced from PubChem (CID 11580230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).