C17H34O2Si — CID 11580263
(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylnona-1,8-dien-4-ol (PubChem CID 11580263) has the molecular formula C17H34O2Si and a molecular weight of 298.54 g/mol. Its IUPAC name is (4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylnona-1,8-dien-4-ol.
| Compound Name | (4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylnona-1,8-dien-4-ol |
|---|---|
| PubChem CID | 11580263 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylnona-1,8-dien-4-ol |
| SMILES | C=CC[C@@H](O)C(C)(C)[C@@H](CC=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O2Si/c1-10-12-14(18)17(6,7)15(13-11-2)19-20(8,9)16(3,4)5/h10-11,14-15,18H,1-2,12-13H2,3-9H3/t14-,15-/m1/s1 |
| InChIKey | PWSKAJLMYKRXIH-HUUCEWRRSA-N |
| XLogP | 4.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|