C18H24N4O — CID 11580445
3-ethyl-N-[[(1S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl]imidazo[1,5-a]pyridine-1-carboxamide (PubChem CID 11580445) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 3-ethyl-N-[[(1S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl]imidazo[1,5-a]pyridine-1-carboxamide.
| Compound Name | 3-ethyl-N-[[(1S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl]imidazo[1,5-a]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 11580445 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 3-ethyl-N-[[(1S,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl]imidazo[1,5-a]pyridine-1-carboxamide |
| SMILES | CCc1nc(C(=O)NC[C@@H]2CCN3CCC[C@@H]23)c2ccccn12 |
| InChI | InChI=1S/C18H24N4O/c1-2-16-20-17(15-6-3-4-10-22(15)16)18(23)19-12-13-8-11-21-9-5-7-14(13)21/h3-4,6,10,13-14H,2,5,7-9,11-12H2,1H3,(H,19,23)/t13-,14-/m0/s1 |
| InChIKey | IPHCPNIQDFAJPA-KBPBESRZSA-N |
| XLogP | 2.11 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |