C14H15BrN2O3S — CID 115804705
(4-bromo-1-propylpyrazol-5-yl)-(4-methylsulfonylphenyl)methanone (PubChem CID 115804705) has the molecular formula C14H15BrN2O3S and a molecular weight of 371.26 g/mol. Its IUPAC name is (4-bromo-1-propylpyrazol-5-yl)-(4-methylsulfonylphenyl)methanone.
| Compound Name | (4-bromo-1-propylpyrazol-5-yl)-(4-methylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 115804705 |
| Molecular Formula | C14H15BrN2O3S |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | (4-bromo-1-propylpyrazol-5-yl)-(4-methylsulfonylphenyl)methanone |
| SMILES | CCCn1ncc(Br)c1C(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H15BrN2O3S/c1-3-8-17-13(12(15)9-16-17)14(18)10-4-6-11(7-5-10)21(2,19)20/h4-7,9H,3,8H2,1-2H3 |
| InChIKey | MNOCSUCUQALUCK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |