C15H15BrF2N2 — CID 115805273
N-[(2-bromo-5-fluorophenyl)-(5-fluoro-3-pyridinyl)methyl]propan-1-amine (PubChem CID 115805273) has the molecular formula C15H15BrF2N2 and a molecular weight of 341.20 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)-(5-fluoro-3-pyridinyl)methyl]propan-1-amine.
| Compound Name | N-[(2-bromo-5-fluorophenyl)-(5-fluoro-3-pyridinyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 115805273 |
| Molecular Formula | C15H15BrF2N2 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)-(5-fluoro-3-pyridinyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cncc(F)c1)c1cc(F)ccc1Br |
| InChI | InChI=1S/C15H15BrF2N2/c1-2-5-20-15(10-6-12(18)9-19-8-10)13-7-11(17)3-4-14(13)16/h3-4,6-9,15,20H,2,5H2,1H3 |
| InChIKey | MWFFSLGQBYRELO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |