About (4-bromo-2,6-difluorophenyl)-(3,5-dimethylcyclohexyl)methanol
(4-bromo-2,6-difluorophenyl)-(3,5-dimethylcyclohexyl)methanol (PubChem CID 115805778) has the molecular formula C15H19BrF2O
and a molecular weight of 333.22 g/mol. Its IUPAC name is (4-bromo-2,6-difluorophenyl)-(3,5-dimethylcyclohexyl)methanol.
Molecular Properties
| Compound Name | (4-bromo-2,6-difluorophenyl)-(3,5-dimethylcyclohexyl)methanol |
| PubChem CID | 115805778 |
| Molecular Formula | C15H19BrF2O |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | (4-bromo-2,6-difluorophenyl)-(3,5-dimethylcyclohexyl)methanol |
| SMILES | CC1CC(C)CC(C(O)c2c(F)cc(Br)cc2F)C1 |
| InChI | InChI=1S/C15H19BrF2O/c1-8-3-9(2)5-10(4-8)15(19)14-12(17)6-11(16)7-13(14)18/h6-10,15,19H,3-5H2,1-2H3 |
| InChIKey | LTGZRCGIUCFMKM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4-bromo-2,6-difluorophenyl)-(3,5-dimethylcyclohexyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2,6-difluorophenyl)-(3,5-dimethylcyclohexyl)methanol?
The IUPAC name of (4-bromo-2,6-difluorophenyl)-(3,5-dimethylcyclohexyl)methanol (CID 115805778) is (4-bromo-2,6-difluorophenyl)-(3,5-dimethylcyclohexyl)methanol.
What is the SMILES notation for (4-bromo-2,6-difluorophenyl)-(3,5-dimethylcyclohexyl)methanol?
The canonical SMILES for (4-bromo-2,6-difluorophenyl)-(3,5-dimethylcyclohexyl)methanol is CC1CC(C)CC(C(O)c2c(F)cc(Br)cc2F)C1.
What is the InChIKey of (4-bromo-2,6-difluorophenyl)-(3,5-dimethylcyclohexyl)methanol?
The InChIKey is LTGZRCGIUCFMKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19BrF2O/c1-8-3-9(2)5-10(4-8)15(19)14-12(17)6-11(16)7-13(14)18/h6-10,15,19H,3-5H2,1-2H3.
What are the key properties of (4-bromo-2,6-difluorophenyl)-(3,5-dimethylcyclohexyl)methanol?
(4-bromo-2,6-difluorophenyl)-(3,5-dimethylcyclohexyl)methanol has a molecular weight of 333.22 g/mol, XLogP of 4.83, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2,6-difluorophenyl)-(3,5-dimethylcyclohexyl)methanol is sourced from PubChem (CID 115805778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).