C15H17F3N2O — CID 115806450
2-(1-butan-2-ylpyrazol-3-yl)-1-(2,4,6-trifluorophenyl)ethanol (PubChem CID 115806450) has the molecular formula C15H17F3N2O and a molecular weight of 298.31 g/mol. Its IUPAC name is 2-(1-butan-2-ylpyrazol-3-yl)-1-(2,4,6-trifluorophenyl)ethanol.
| Compound Name | 2-(1-butan-2-ylpyrazol-3-yl)-1-(2,4,6-trifluorophenyl)ethanol |
|---|---|
| PubChem CID | 115806450 |
| Molecular Formula | C15H17F3N2O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-(1-butan-2-ylpyrazol-3-yl)-1-(2,4,6-trifluorophenyl)ethanol |
| SMILES | CCC(C)n1ccc(CC(O)c2c(F)cc(F)cc2F)n1 |
| InChI | InChI=1S/C15H17F3N2O/c1-3-9(2)20-5-4-11(19-20)8-14(21)15-12(17)6-10(16)7-13(15)18/h4-7,9,14,21H,3,8H2,1-2H3 |
| InChIKey | ZUZQARPBXBIMRA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |