C20H22FNS — CID 11580699
1-[(2S,4R,6R)-17-fluoro-3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]-N,N-dimethylmethanamine (PubChem CID 11580699) has the molecular formula C20H22FNS and a molecular weight of 327.47 g/mol. Its IUPAC name is 1-[(2S,4R,6R)-17-fluoro-3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(2S,4R,6R)-17-fluoro-3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 11580699 |
| Molecular Formula | C20H22FNS |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-[(2S,4R,6R)-17-fluoro-3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)C[C@H]1C[C@@H]2c3ccccc3Cc3ccc(F)cc3[C@H]2S1 |
| InChI | InChI=1S/C20H22FNS/c1-22(2)12-16-11-19-17-6-4-3-5-13(17)9-14-7-8-15(21)10-18(14)20(19)23-16/h3-8,10,16,19-20H,9,11-12H2,1-2H3/t16-,19-,20-/m1/s1 |
| InChIKey | GRXPWFLIZOGNKT-NSISKUIASA-N |
| XLogP | 4.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |