About 5,7-dimethoxy-3-(4-methoxyphenyl)-1H-quinazoline-2,4-dione
5,7-dimethoxy-3-(4-methoxyphenyl)-1H-quinazoline-2,4-dione (PubChem CID 11580706) has the molecular formula C17H16N2O5
and a molecular weight of 328.32 g/mol. Its IUPAC name is 5,7-dimethoxy-3-(4-methoxyphenyl)-1H-quinazoline-2,4-dione.
Molecular Properties
| Compound Name | 5,7-dimethoxy-3-(4-methoxyphenyl)-1H-quinazoline-2,4-dione |
| PubChem CID | 11580706 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 5,7-dimethoxy-3-(4-methoxyphenyl)-1H-quinazoline-2,4-dione |
| SMILES | COc1ccc(-n2c(=O)[nH]c3cc(OC)cc(OC)c3c2=O)cc1 |
| InChI | InChI=1S/C17H16N2O5/c1-22-11-6-4-10(5-7-11)19-16(20)15-13(18-17(19)21)8-12(23-2)9-14(15)24-3/h4-9H,1-3H3,(H,18,21) |
| InChIKey | ATWNKDPBEUEDEN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5,7-dimethoxy-3-(4-methoxyphenyl)-1H-quinazoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethoxy-3-(4-methoxyphenyl)-1H-quinazoline-2,4-dione?
The IUPAC name of 5,7-dimethoxy-3-(4-methoxyphenyl)-1H-quinazoline-2,4-dione (CID 11580706) is 5,7-dimethoxy-3-(4-methoxyphenyl)-1H-quinazoline-2,4-dione.
What is the SMILES notation for 5,7-dimethoxy-3-(4-methoxyphenyl)-1H-quinazoline-2,4-dione?
The canonical SMILES for 5,7-dimethoxy-3-(4-methoxyphenyl)-1H-quinazoline-2,4-dione is COc1ccc(-n2c(=O)[nH]c3cc(OC)cc(OC)c3c2=O)cc1.
What is the InChIKey of 5,7-dimethoxy-3-(4-methoxyphenyl)-1H-quinazoline-2,4-dione?
The InChIKey is ATWNKDPBEUEDEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O5/c1-22-11-6-4-10(5-7-11)19-16(20)15-13(18-17(19)21)8-12(23-2)9-14(15)24-3/h4-9H,1-3H3,(H,18,21).
What are the key properties of 5,7-dimethoxy-3-(4-methoxyphenyl)-1H-quinazoline-2,4-dione?
5,7-dimethoxy-3-(4-methoxyphenyl)-1H-quinazoline-2,4-dione has a molecular weight of 328.32 g/mol, XLogP of 1.70, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethoxy-3-(4-methoxyphenyl)-1H-quinazoline-2,4-dione is sourced from PubChem (CID 11580706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).