C16H34O3Si2 — CID 11580763
(2S,3R)-3-[tert-butyl(dimethyl)silyl]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxirane-2-carbaldehyde (PubChem CID 11580763) has the molecular formula C16H34O3Si2 and a molecular weight of 330.62 g/mol. Its IUPAC name is (2S,3R)-3-[tert-butyl(dimethyl)silyl]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxirane-2-carbaldehyde.
| Compound Name | (2S,3R)-3-[tert-butyl(dimethyl)silyl]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxirane-2-carbaldehyde |
|---|---|
| PubChem CID | 11580763 |
| Molecular Formula | C16H34O3Si2 |
| Molecular Weight | 330.62 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (2S,3R)-3-[tert-butyl(dimethyl)silyl]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxirane-2-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@]1(C=O)O[C@@H]1[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H34O3Si2/c1-14(2,3)20(7,8)13-16(11-17,19-13)12-18-21(9,10)15(4,5)6/h11,13H,12H2,1-10H3/t13-,16-/m1/s1 |
| InChIKey | QXFNPLWTSJNYMD-CZUORRHYSA-N |
| XLogP | 4.39 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|