About methyl (3S,4R)-4-(2-chloro-5,7-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate
methyl (3S,4R)-4-(2-chloro-5,7-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate (PubChem CID 11580791) has the molecular formula C18H21ClN2O2
and a molecular weight of 332.83 g/mol. Its IUPAC name is methyl (3S,4R)-4-(2-chloro-5,7-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate.
Molecular Properties
| Compound Name | methyl (3S,4R)-4-(2-chloro-5,7-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate |
| PubChem CID | 11580791 |
| Molecular Formula | C18H21ClN2O2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | methyl (3S,4R)-4-(2-chloro-5,7-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CN(C)C[C@H]1c1cc2c(C)cc(C)cc2nc1Cl |
| InChI | InChI=1S/C18H21ClN2O2/c1-10-5-11(2)12-7-13(17(19)20-16(12)6-10)14-8-21(3)9-15(14)18(22)23-4/h5-7,14-15H,8-9H2,1-4H3/t14-,15+/m0/s1 |
| InChIKey | YRYFGPSJPFBUJE-LSDHHAIUSA-N |
| XLogP | 3.32 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl (3S,4R)-4-(2-chloro-5,7-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S,4R)-4-(2-chloro-5,7-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate?
The IUPAC name of methyl (3S,4R)-4-(2-chloro-5,7-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate (CID 11580791) is methyl (3S,4R)-4-(2-chloro-5,7-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate.
What is the SMILES notation for methyl (3S,4R)-4-(2-chloro-5,7-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate?
The canonical SMILES for methyl (3S,4R)-4-(2-chloro-5,7-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate is COC(=O)[C@@H]1CN(C)C[C@H]1c1cc2c(C)cc(C)cc2nc1Cl.
What is the InChIKey of methyl (3S,4R)-4-(2-chloro-5,7-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate?
The InChIKey is YRYFGPSJPFBUJE-LSDHHAIUSA-N. The full InChI is InChI=1S/C18H21ClN2O2/c1-10-5-11(2)12-7-13(17(19)20-16(12)6-10)14-8-21(3)9-15(14)18(22)23-4/h5-7,14-15H,8-9H2,1-4H3/t14-,15+/m0/s1.
What are the key properties of methyl (3S,4R)-4-(2-chloro-5,7-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate?
methyl (3S,4R)-4-(2-chloro-5,7-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate has a molecular weight of 332.83 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S,4R)-4-(2-chloro-5,7-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate is sourced from PubChem (CID 11580791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).