C17H22O2 — CID 115808081
3,4,4-trimethyl-1-(5-methyl-1-benzofuran-2-yl)pentan-1-one (PubChem CID 115808081) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 3,4,4-trimethyl-1-(5-methyl-1-benzofuran-2-yl)pentan-1-one.
| Compound Name | 3,4,4-trimethyl-1-(5-methyl-1-benzofuran-2-yl)pentan-1-one |
|---|---|
| PubChem CID | 115808081 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 3,4,4-trimethyl-1-(5-methyl-1-benzofuran-2-yl)pentan-1-one |
| SMILES | Cc1ccc2oc(C(=O)CC(C)C(C)(C)C)cc2c1 |
| InChI | InChI=1S/C17H22O2/c1-11-6-7-15-13(8-11)10-16(19-15)14(18)9-12(2)17(3,4)5/h6-8,10,12H,9H2,1-5H3 |
| InChIKey | CPFRXZJHOMYXSA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |