C18H18N6O — CID 11580817
N'-[2-(furan-2-yl)pyrimido[5,4-c]cinnolin-4-yl]-N-methylpropane-1,3-diamine (PubChem CID 11580817) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is N'-[2-(furan-2-yl)pyrimido[5,4-c]cinnolin-4-yl]-N-methylpropane-1,3-diamine.
| Compound Name | N'-[2-(furan-2-yl)pyrimido[5,4-c]cinnolin-4-yl]-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 11580817 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N'-[2-(furan-2-yl)pyrimido[5,4-c]cinnolin-4-yl]-N-methylpropane-1,3-diamine |
| SMILES | CNCCCNc1nc(-c2ccco2)nc2c1nnc1ccccc12 |
| InChI | InChI=1S/C18H18N6O/c1-19-9-5-10-20-18-16-15(12-6-2-3-7-13(12)23-24-16)21-17(22-18)14-8-4-11-25-14/h2-4,6-8,11,19H,5,9-10H2,1H3,(H,20,21,22) |
| InChIKey | SKUFNMBQAVRJSM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|