C13H15N3O6S — CID 11580929
4-[2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]hydrazinyl]benzenesulfonamide (PubChem CID 11580929) has the molecular formula C13H15N3O6S and a molecular weight of 341.35 g/mol. Its IUPAC name is 4-[2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]hydrazinyl]benzenesulfonamide.
| Compound Name | 4-[2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11580929 |
| Molecular Formula | C13H15N3O6S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 4-[2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]hydrazinyl]benzenesulfonamide |
| SMILES | CC1(C)OC(=O)C(=CNNc2ccc(S(N)(=O)=O)cc2)C(=O)O1 |
| InChI | InChI=1S/C13H15N3O6S/c1-13(2)21-11(17)10(12(18)22-13)7-15-16-8-3-5-9(6-4-8)23(14,19)20/h3-7,15-16H,1-2H3,(H2,14,19,20) |
| InChIKey | WBEALNJXJFLWSU-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|