C13H16BrClO2 — CID 115809368
1-(5-bromo-2-chlorophenyl)-3-(oxolan-2-yl)propan-1-ol (PubChem CID 115809368) has the molecular formula C13H16BrClO2 and a molecular weight of 319.63 g/mol. Its IUPAC name is 1-(5-bromo-2-chlorophenyl)-3-(oxolan-2-yl)propan-1-ol.
| Compound Name | 1-(5-bromo-2-chlorophenyl)-3-(oxolan-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 115809368 |
| Molecular Formula | C13H16BrClO2 |
| Molecular Weight | 319.63 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 1-(5-bromo-2-chlorophenyl)-3-(oxolan-2-yl)propan-1-ol |
| SMILES | OC(CCC1CCCO1)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C13H16BrClO2/c14-9-3-5-12(15)11(8-9)13(16)6-4-10-2-1-7-17-10/h3,5,8,10,13,16H,1-2,4,6-7H2 |
| InChIKey | JSBMSCJPRJYKPY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.63 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |