About (2S,5S)-1-(2-methylphenyl)-2,5-diphenyl-1λ5-phospholane 1-oxide
(2S,5S)-1-(2-methylphenyl)-2,5-diphenyl-1λ5-phospholane 1-oxide (PubChem CID 11581020) has the molecular formula C23H23OP
and a molecular weight of 346.41 g/mol. Its IUPAC name is (2S,5S)-1-(2-methylphenyl)-2,5-diphenyl-1λ5-phospholane 1-oxide.
Molecular Properties
| Compound Name | (2S,5S)-1-(2-methylphenyl)-2,5-diphenyl-1λ5-phospholane 1-oxide |
| PubChem CID | 11581020 |
| Molecular Formula | C23H23OP |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (2S,5S)-1-(2-methylphenyl)-2,5-diphenyl-1λ5-phospholane 1-oxide |
| SMILES | Cc1ccccc1P1(=O)[C@H](c2ccccc2)CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H23OP/c1-18-10-8-9-15-21(18)25(24)22(19-11-4-2-5-12-19)16-17-23(25)20-13-6-3-7-14-20/h2-15,22-23H,16-17H2,1H3/t22-,23-/m0/s1 |
| InChIKey | WBOXPALRKSVGFY-GOTSBHOMSA-N |
| XLogP | 6.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2S,5S)-1-(2-methylphenyl)-2,5-diphenyl-1λ5-phospholane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-1-(2-methylphenyl)-2,5-diphenyl-1λ5-phospholane 1-oxide?
The IUPAC name of (2S,5S)-1-(2-methylphenyl)-2,5-diphenyl-1λ5-phospholane 1-oxide (CID 11581020) is (2S,5S)-1-(2-methylphenyl)-2,5-diphenyl-1λ5-phospholane 1-oxide.
What is the SMILES notation for (2S,5S)-1-(2-methylphenyl)-2,5-diphenyl-1λ5-phospholane 1-oxide?
The canonical SMILES for (2S,5S)-1-(2-methylphenyl)-2,5-diphenyl-1λ5-phospholane 1-oxide is Cc1ccccc1P1(=O)[C@H](c2ccccc2)CC[C@H]1c1ccccc1.
What is the InChIKey of (2S,5S)-1-(2-methylphenyl)-2,5-diphenyl-1λ5-phospholane 1-oxide?
The InChIKey is WBOXPALRKSVGFY-GOTSBHOMSA-N. The full InChI is InChI=1S/C23H23OP/c1-18-10-8-9-15-21(18)25(24)22(19-11-4-2-5-12-19)16-17-23(25)20-13-6-3-7-14-20/h2-15,22-23H,16-17H2,1H3/t22-,23-/m0/s1.
What are the key properties of (2S,5S)-1-(2-methylphenyl)-2,5-diphenyl-1λ5-phospholane 1-oxide?
(2S,5S)-1-(2-methylphenyl)-2,5-diphenyl-1λ5-phospholane 1-oxide has a molecular weight of 346.41 g/mol, XLogP of 6.26, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-1-(2-methylphenyl)-2,5-diphenyl-1λ5-phospholane 1-oxide is sourced from PubChem (CID 11581020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).