About 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine;hydrochloride
1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine;hydrochloride (PubChem CID 11581052) has the molecular formula C21H30ClNO
and a molecular weight of 347.93 g/mol. Its IUPAC name is 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine;hydrochloride.
Molecular Properties
| Compound Name | 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine;hydrochloride |
| PubChem CID | 11581052 |
| Molecular Formula | C21H30ClNO |
| Molecular Weight | 347.93 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine;hydrochloride |
| SMILES | COc1ccc2c(CCCN3CCCC(C)(C)C3)cccc2c1.Cl |
| InChI | InChI=1S/C21H29NO.ClH/c1-21(2)12-6-14-22(16-21)13-5-9-17-7-4-8-18-15-19(23-3)10-11-20(17)18;/h4,7-8,10-11,15H,5-6,9,12-14,16H2,1-3H3;1H |
| InChIKey | BUEIXMWEXNCJJA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.93 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine;hydrochloride?
The IUPAC name of 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine;hydrochloride (CID 11581052) is 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine;hydrochloride.
What is the SMILES notation for 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine;hydrochloride?
The canonical SMILES for 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine;hydrochloride is COc1ccc2c(CCCN3CCCC(C)(C)C3)cccc2c1.Cl.
What is the InChIKey of 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine;hydrochloride?
The InChIKey is BUEIXMWEXNCJJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29NO.ClH/c1-21(2)12-6-14-22(16-21)13-5-9-17-7-4-8-18-15-19(23-3)10-11-20(17)18;/h4,7-8,10-11,15H,5-6,9,12-14,16H2,1-3H3;1H.
What are the key properties of 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine;hydrochloride?
1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine;hydrochloride has a molecular weight of 347.93 g/mol, XLogP of 5.32, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine;hydrochloride is sourced from PubChem (CID 11581052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).