About 1-cyclopropyl-4,5-dimethylhexan-3-ol
1-cyclopropyl-4,5-dimethylhexan-3-ol (PubChem CID 115810725) has the molecular formula C11H22O
and a molecular weight of 170.30 g/mol. Its IUPAC name is 1-cyclopropyl-4,5-dimethylhexan-3-ol.
Molecular Properties
| Compound Name | 1-cyclopropyl-4,5-dimethylhexan-3-ol |
| PubChem CID | 115810725 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | 1-cyclopropyl-4,5-dimethylhexan-3-ol |
| SMILES | CC(C)C(C)C(O)CCC1CC1 |
| InChI | InChI=1S/C11H22O/c1-8(2)9(3)11(12)7-6-10-4-5-10/h8-12H,4-7H2,1-3H3 |
| InChIKey | ODDUOVZQTDSHLP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopropyl-4,5-dimethylhexan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-4,5-dimethylhexan-3-ol?
The IUPAC name of 1-cyclopropyl-4,5-dimethylhexan-3-ol (CID 115810725) is 1-cyclopropyl-4,5-dimethylhexan-3-ol.
What is the SMILES notation for 1-cyclopropyl-4,5-dimethylhexan-3-ol?
The canonical SMILES for 1-cyclopropyl-4,5-dimethylhexan-3-ol is CC(C)C(C)C(O)CCC1CC1.
What is the InChIKey of 1-cyclopropyl-4,5-dimethylhexan-3-ol?
The InChIKey is ODDUOVZQTDSHLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O/c1-8(2)9(3)11(12)7-6-10-4-5-10/h8-12H,4-7H2,1-3H3.
What are the key properties of 1-cyclopropyl-4,5-dimethylhexan-3-ol?
1-cyclopropyl-4,5-dimethylhexan-3-ol has a molecular weight of 170.30 g/mol, XLogP of 2.83, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-4,5-dimethylhexan-3-ol is sourced from PubChem (CID 115810725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).