C15H6Cl2F2O2 — CID 115810891
(7-chloro-1-benzofuran-2-yl)-(4-chloro-2,5-difluorophenyl)methanone (PubChem CID 115810891) has the molecular formula C15H6Cl2F2O2 and a molecular weight of 327.11 g/mol. Its IUPAC name is (7-chloro-1-benzofuran-2-yl)-(4-chloro-2,5-difluorophenyl)methanone.
| Compound Name | (7-chloro-1-benzofuran-2-yl)-(4-chloro-2,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 115810891 |
| Molecular Formula | C15H6Cl2F2O2 |
| Molecular Weight | 327.11 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | (7-chloro-1-benzofuran-2-yl)-(4-chloro-2,5-difluorophenyl)methanone |
| SMILES | O=C(c1cc2cccc(Cl)c2o1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C15H6Cl2F2O2/c16-9-3-1-2-7-4-13(21-15(7)9)14(20)8-5-12(19)10(17)6-11(8)18/h1-6H |
| InChIKey | MKJVPBJDMXRUEL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.11 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|