About cyclobutyl(thieno[3,2-b]thiophen-5-yl)methanone
cyclobutyl(thieno[3,2-b]thiophen-5-yl)methanone (PubChem CID 115811428) has the molecular formula C11H10OS2
and a molecular weight of 222.33 g/mol. Its IUPAC name is cyclobutyl(thieno[3,2-b]thiophen-5-yl)methanone.
Molecular Properties
| Compound Name | cyclobutyl(thieno[3,2-b]thiophen-5-yl)methanone |
| PubChem CID | 115811428 |
| Molecular Formula | C11H10OS2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | cyclobutyl(thieno[3,2-b]thiophen-5-yl)methanone |
| SMILES | O=C(c1cc2sccc2s1)C1CCC1 |
| InChI | InChI=1S/C11H10OS2/c12-11(7-2-1-3-7)10-6-9-8(14-10)4-5-13-9/h4-7H,1-3H2 |
| InChIKey | YVLHRAPJAHUJCY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclobutyl(thieno[3,2-b]thiophen-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyl(thieno[3,2-b]thiophen-5-yl)methanone?
The IUPAC name of cyclobutyl(thieno[3,2-b]thiophen-5-yl)methanone (CID 115811428) is cyclobutyl(thieno[3,2-b]thiophen-5-yl)methanone.
What is the SMILES notation for cyclobutyl(thieno[3,2-b]thiophen-5-yl)methanone?
The canonical SMILES for cyclobutyl(thieno[3,2-b]thiophen-5-yl)methanone is O=C(c1cc2sccc2s1)C1CCC1.
What is the InChIKey of cyclobutyl(thieno[3,2-b]thiophen-5-yl)methanone?
The InChIKey is YVLHRAPJAHUJCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10OS2/c12-11(7-2-1-3-7)10-6-9-8(14-10)4-5-13-9/h4-7H,1-3H2.
What are the key properties of cyclobutyl(thieno[3,2-b]thiophen-5-yl)methanone?
cyclobutyl(thieno[3,2-b]thiophen-5-yl)methanone has a molecular weight of 222.33 g/mol, XLogP of 3.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl(thieno[3,2-b]thiophen-5-yl)methanone is sourced from PubChem (CID 115811428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).