C13H20N2O2 — CID 115811846
1-(1-methylimidazol-2-yl)-5-(oxolan-2-yl)pentan-3-one (PubChem CID 115811846) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-(1-methylimidazol-2-yl)-5-(oxolan-2-yl)pentan-3-one.
| Compound Name | 1-(1-methylimidazol-2-yl)-5-(oxolan-2-yl)pentan-3-one |
|---|---|
| PubChem CID | 115811846 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-(1-methylimidazol-2-yl)-5-(oxolan-2-yl)pentan-3-one |
| SMILES | Cn1ccnc1CCC(=O)CCC1CCCO1 |
| InChI | InChI=1S/C13H20N2O2/c1-15-9-8-14-13(15)7-5-11(16)4-6-12-3-2-10-17-12/h8-9,12H,2-7,10H2,1H3 |
| InChIKey | QKNVCTIETCPUAB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |