About [4-[4-cyano-3-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl] sulfamate
[4-[4-cyano-3-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl] sulfamate (PubChem CID 11581191) has the molecular formula C16H13N5O3S
and a molecular weight of 355.38 g/mol. Its IUPAC name is [4-[4-cyano-3-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl] sulfamate.
Molecular Properties
| Compound Name | [4-[4-cyano-3-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl] sulfamate |
| PubChem CID | 11581191 |
| Molecular Formula | C16H13N5O3S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | [4-[4-cyano-3-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl] sulfamate |
| SMILES | N#Cc1ccc(-c2ccc(OS(N)(=O)=O)cc2)cc1Cn1cncn1 |
| InChI | InChI=1S/C16H13N5O3S/c17-8-14-2-1-13(7-15(14)9-21-11-19-10-20-21)12-3-5-16(6-4-12)24-25(18,22)23/h1-7,10-11H,9H2,(H2,18,22,23) |
| InChIKey | WWRCRHIFZODGAF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 123.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [4-[4-cyano-3-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl] sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-cyano-3-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl] sulfamate?
The IUPAC name of [4-[4-cyano-3-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl] sulfamate (CID 11581191) is [4-[4-cyano-3-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl] sulfamate.
What is the SMILES notation for [4-[4-cyano-3-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl] sulfamate?
The canonical SMILES for [4-[4-cyano-3-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl] sulfamate is N#Cc1ccc(-c2ccc(OS(N)(=O)=O)cc2)cc1Cn1cncn1.
What is the InChIKey of [4-[4-cyano-3-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl] sulfamate?
The InChIKey is WWRCRHIFZODGAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N5O3S/c17-8-14-2-1-13(7-15(14)9-21-11-19-10-20-21)12-3-5-16(6-4-12)24-25(18,22)23/h1-7,10-11H,9H2,(H2,18,22,23).
What are the key properties of [4-[4-cyano-3-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl] sulfamate?
[4-[4-cyano-3-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl] sulfamate has a molecular weight of 355.38 g/mol, XLogP of 1.45, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-cyano-3-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl] sulfamate is sourced from PubChem (CID 11581191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).