C16H11BrF2O2 — CID 115812876
(4-bromo-2,6-difluorophenyl)-(4-cyclopropyloxyphenyl)methanone (PubChem CID 115812876) has the molecular formula C16H11BrF2O2 and a molecular weight of 353.16 g/mol. Its IUPAC name is (4-bromo-2,6-difluorophenyl)-(4-cyclopropyloxyphenyl)methanone.
| Compound Name | (4-bromo-2,6-difluorophenyl)-(4-cyclopropyloxyphenyl)methanone |
|---|---|
| PubChem CID | 115812876 |
| Molecular Formula | C16H11BrF2O2 |
| Molecular Weight | 353.16 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | (4-bromo-2,6-difluorophenyl)-(4-cyclopropyloxyphenyl)methanone |
| SMILES | O=C(c1ccc(OC2CC2)cc1)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C16H11BrF2O2/c17-10-7-13(18)15(14(19)8-10)16(20)9-1-3-11(4-2-9)21-12-5-6-12/h1-4,7-8,12H,5-6H2 |
| InChIKey | ZNEGCSSVVPGKRJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.16 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |