C22H32O4 — CID 11581288
(4aS,9aR)-5,6,8-trimethoxy-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9a-tetrahydrofluoren-9-one (PubChem CID 11581288) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (4aS,9aR)-5,6,8-trimethoxy-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9a-tetrahydrofluoren-9-one.
| Compound Name | (4aS,9aR)-5,6,8-trimethoxy-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9a-tetrahydrofluoren-9-one |
|---|---|
| PubChem CID | 11581288 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (4aS,9aR)-5,6,8-trimethoxy-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9a-tetrahydrofluoren-9-one |
| SMILES | COc1c(OC)c2c(c(OC)c1C(C)C)C(=O)[C@@H]1C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C22H32O4/c1-12(2)13-17(24-6)14-15(19(26-8)18(13)25-7)22(5)11-9-10-21(3,4)20(22)16(14)23/h12,20H,9-11H2,1-8H3/t20-,22-/m1/s1 |
| InChIKey | WVFFBYDELJDCQL-IFMALSPDSA-N |
| XLogP | 5.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |