C23H40O3 — CID 11581375
(2R)-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]propane-1,2-diol (PubChem CID 11581375) has the molecular formula C23H40O3 and a molecular weight of 364.57 g/mol. Its IUPAC name is (2R)-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]propane-1,2-diol.
| Compound Name | (2R)-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 11581375 |
| Molecular Formula | C23H40O3 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | (2R)-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]propane-1,2-diol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/COC[C@H](O)CO |
| InChI | InChI=1S/C23H40O3/c1-19(2)9-6-10-20(3)11-7-12-21(4)13-8-14-22(5)15-16-26-18-23(25)17-24/h9,11,13,15,23-25H,6-8,10,12,14,16-18H2,1-5H3/b20-11+,21-13+,22-15+/t23-/m1/s1 |
| InChIKey | DOQOVRQWQQJATN-IGQSPZABSA-N |
| XLogP | 5.50 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|