C13H17IO2S — CID 115814115
(5-iodothiophen-3-yl)-(2,2,5,5-tetramethyloxolan-3-yl)methanone (PubChem CID 115814115) has the molecular formula C13H17IO2S and a molecular weight of 364.25 g/mol. Its IUPAC name is (5-iodothiophen-3-yl)-(2,2,5,5-tetramethyloxolan-3-yl)methanone.
| Compound Name | (5-iodothiophen-3-yl)-(2,2,5,5-tetramethyloxolan-3-yl)methanone |
|---|---|
| PubChem CID | 115814115 |
| Molecular Formula | C13H17IO2S |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | (5-iodothiophen-3-yl)-(2,2,5,5-tetramethyloxolan-3-yl)methanone |
| SMILES | CC1(C)CC(C(=O)c2csc(I)c2)C(C)(C)O1 |
| InChI | InChI=1S/C13H17IO2S/c1-12(2)6-9(13(3,4)16-12)11(15)8-5-10(14)17-7-8/h5,7,9H,6H2,1-4H3 |
| InChIKey | NKGXSKMHXCZNTM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|