About 5-methyloct-1-en-4-amine
5-methyloct-1-en-4-amine (PubChem CID 115814387) has the molecular formula C9H19N
and a molecular weight of 141.26 g/mol. Its IUPAC name is 5-methyloct-1-en-4-amine.
Molecular Properties
| Compound Name | 5-methyloct-1-en-4-amine |
| PubChem CID | 115814387 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 5-methyloct-1-en-4-amine |
| SMILES | C=CCC(N)C(C)CCC |
| InChI | InChI=1S/C9H19N/c1-4-6-8(3)9(10)7-5-2/h5,8-9H,2,4,6-7,10H2,1,3H3 |
| InChIKey | UNRQCQNECYKDSH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyloct-1-en-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyloct-1-en-4-amine?
The IUPAC name of 5-methyloct-1-en-4-amine (CID 115814387) is 5-methyloct-1-en-4-amine.
What is the SMILES notation for 5-methyloct-1-en-4-amine?
The canonical SMILES for 5-methyloct-1-en-4-amine is C=CCC(N)C(C)CCC.
What is the InChIKey of 5-methyloct-1-en-4-amine?
The InChIKey is UNRQCQNECYKDSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N/c1-4-6-8(3)9(10)7-5-2/h5,8-9H,2,4,6-7,10H2,1,3H3.
What are the key properties of 5-methyloct-1-en-4-amine?
5-methyloct-1-en-4-amine has a molecular weight of 141.26 g/mol, XLogP of 2.33, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyloct-1-en-4-amine is sourced from PubChem (CID 115814387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).