C17H20BrN — CID 115814812
1-(6-bromonaphthalen-2-yl)-N-propylbut-3-en-1-amine (PubChem CID 115814812) has the molecular formula C17H20BrN and a molecular weight of 318.26 g/mol. Its IUPAC name is 1-(6-bromonaphthalen-2-yl)-N-propylbut-3-en-1-amine.
| Compound Name | 1-(6-bromonaphthalen-2-yl)-N-propylbut-3-en-1-amine |
|---|---|
| PubChem CID | 115814812 |
| Molecular Formula | C17H20BrN |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 1-(6-bromonaphthalen-2-yl)-N-propylbut-3-en-1-amine |
| SMILES | C=CCC(NCCC)c1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C17H20BrN/c1-3-5-17(19-10-4-2)15-7-6-14-12-16(18)9-8-13(14)11-15/h3,6-9,11-12,17,19H,1,4-5,10H2,2H3 |
| InChIKey | ZHFZEXNVEJBGBU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|