About 2-methylpropyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate
2-methylpropyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate (PubChem CID 11581554) has the molecular formula C17H21F2NO4S
and a molecular weight of 373.42 g/mol. Its IUPAC name is 2-methylpropyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate.
Molecular Properties
| Compound Name | 2-methylpropyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate |
| PubChem CID | 11581554 |
| Molecular Formula | C17H21F2NO4S |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-methylpropyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate |
| SMILES | CC(C)COC(=O)C1=CCCCC1S(=O)(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C17H21F2NO4S/c1-11(2)10-24-17(21)13-5-3-4-6-16(13)25(22,23)20-15-8-7-12(18)9-14(15)19/h5,7-9,11,16,20H,3-4,6,10H2,1-2H3 |
| InChIKey | KELFSGJXSPYNIW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpropyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate?
The IUPAC name of 2-methylpropyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate (CID 11581554) is 2-methylpropyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate.
What is the SMILES notation for 2-methylpropyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate?
The canonical SMILES for 2-methylpropyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate is CC(C)COC(=O)C1=CCCCC1S(=O)(=O)Nc1ccc(F)cc1F.
What is the InChIKey of 2-methylpropyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate?
The InChIKey is KELFSGJXSPYNIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F2NO4S/c1-11(2)10-24-17(21)13-5-3-4-6-16(13)25(22,23)20-15-8-7-12(18)9-14(15)19/h5,7-9,11,16,20H,3-4,6,10H2,1-2H3.
What are the key properties of 2-methylpropyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate?
2-methylpropyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate has a molecular weight of 373.42 g/mol, XLogP of 3.38, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate is sourced from PubChem (CID 11581554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).