C14H17BrFN3 — CID 115815982
N-[(2-bromo-5-fluorophenyl)-(1-ethylpyrazol-4-yl)methyl]ethanamine (PubChem CID 115815982) has the molecular formula C14H17BrFN3 and a molecular weight of 326.21 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)-(1-ethylpyrazol-4-yl)methyl]ethanamine.
| Compound Name | N-[(2-bromo-5-fluorophenyl)-(1-ethylpyrazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 115815982 |
| Molecular Formula | C14H17BrFN3 |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)-(1-ethylpyrazol-4-yl)methyl]ethanamine |
| SMILES | CCNC(c1cnn(CC)c1)c1cc(F)ccc1Br |
| InChI | InChI=1S/C14H17BrFN3/c1-3-17-14(10-8-18-19(4-2)9-10)12-7-11(16)5-6-13(12)15/h5-9,14,17H,3-4H2,1-2H3 |
| InChIKey | VBYASGIQLFNFLC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |