C22H34O5 — CID 11581669
(1S,2R,3S,4S)-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2,4-dimethyl-5-phenylmethoxypentane-1,3-diol (PubChem CID 11581669) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is (1S,2R,3S,4S)-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2,4-dimethyl-5-phenylmethoxypentane-1,3-diol.
| Compound Name | (1S,2R,3S,4S)-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2,4-dimethyl-5-phenylmethoxypentane-1,3-diol |
|---|---|
| PubChem CID | 11581669 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (1S,2R,3S,4S)-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2,4-dimethyl-5-phenylmethoxypentane-1,3-diol |
| SMILES | C[C@H]([C@@H](O)[C@@H](C)COCc1ccccc1)[C@H](O)[C@@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C22H34O5/c1-16(13-25-14-18-9-5-3-6-10-18)20(23)17(2)21(24)19-15-26-22(27-19)11-7-4-8-12-22/h3,5-6,9-10,16-17,19-21,23-24H,4,7-8,11-15H2,1-2H3/t16-,17+,19-,20-,21-/m0/s1 |
| InChIKey | RJIAYMIJOLSVBF-ZZEDZQHJSA-N |
| XLogP | 3.27 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |