C15H17Br2NOS — CID 115817250
2-(5-bromo-2-methoxyphenyl)-1-(3-bromothiophen-2-yl)-N-ethylethanamine (PubChem CID 115817250) has the molecular formula C15H17Br2NOS and a molecular weight of 419.18 g/mol. Its IUPAC name is 2-(5-bromo-2-methoxyphenyl)-1-(3-bromothiophen-2-yl)-N-ethylethanamine.
| Compound Name | 2-(5-bromo-2-methoxyphenyl)-1-(3-bromothiophen-2-yl)-N-ethylethanamine |
|---|---|
| PubChem CID | 115817250 |
| Molecular Formula | C15H17Br2NOS |
| Molecular Weight | 419.18 g/mol |
| Exact Mass | 416.94 |
| IUPAC Name | 2-(5-bromo-2-methoxyphenyl)-1-(3-bromothiophen-2-yl)-N-ethylethanamine |
| SMILES | CCNC(Cc1cc(Br)ccc1OC)c1sccc1Br |
| InChI | InChI=1S/C15H17Br2NOS/c1-3-18-13(15-12(17)6-7-20-15)9-10-8-11(16)4-5-14(10)19-2/h4-8,13,18H,3,9H2,1-2H3 |
| InChIKey | QNWQZYMSOMDJDZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.18 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |