C27H28O2 — CID 11581782
(2S,4S,7S)-14-hydroxy-7-methyl-13-(2-phenylethyl)pentacyclo[8.8.0.02,4.02,7.011,16]octadeca-1(10),11,13,15-tetraen-6-one (PubChem CID 11581782) has the molecular formula C27H28O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is (2S,4S,7S)-14-hydroxy-7-methyl-13-(2-phenylethyl)pentacyclo[8.8.0.02,4.02,7.011,16]octadeca-1(10),11,13,15-tetraen-6-one.
| Compound Name | (2S,4S,7S)-14-hydroxy-7-methyl-13-(2-phenylethyl)pentacyclo[8.8.0.02,4.02,7.011,16]octadeca-1(10),11,13,15-tetraen-6-one |
|---|---|
| PubChem CID | 11581782 |
| Molecular Formula | C27H28O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | (2S,4S,7S)-14-hydroxy-7-methyl-13-(2-phenylethyl)pentacyclo[8.8.0.02,4.02,7.011,16]octadeca-1(10),11,13,15-tetraen-6-one |
| SMILES | C[C@]12CCC3=C(CCc4cc(O)c(CCc5ccccc5)cc43)[C@@]13C[C@H]3CC2=O |
| InChI | InChI=1S/C27H28O2/c1-26-12-11-21-22-13-19(8-7-17-5-3-2-4-6-17)24(28)14-18(22)9-10-23(21)27(26)16-20(27)15-25(26)29/h2-6,13-14,20,28H,7-12,15-16H2,1H3/t20-,26-,27+/m1/s1 |
| InChIKey | KWJUEXVBMIPHFD-UIFDUCBYSA-N |
| XLogP | 5.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |