C15H22Cl2F3N3O — CID 11581847
2-cyclopropyl-9-methyl-4-(3,3,3-trifluoropropoxy)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine;dihydrochloride (PubChem CID 11581847) has the molecular formula C15H22Cl2F3N3O and a molecular weight of 388.26 g/mol. Its IUPAC name is 2-cyclopropyl-9-methyl-4-(3,3,3-trifluoropropoxy)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine;dihydrochloride.
| Compound Name | 2-cyclopropyl-9-methyl-4-(3,3,3-trifluoropropoxy)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine;dihydrochloride |
|---|---|
| PubChem CID | 11581847 |
| Molecular Formula | C15H22Cl2F3N3O |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2-cyclopropyl-9-methyl-4-(3,3,3-trifluoropropoxy)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine;dihydrochloride |
| SMILES | CC1CNCCc2c(OCCC(F)(F)F)nc(C3CC3)nc21.Cl.Cl |
| InChI | InChI=1S/C15H20F3N3O.2ClH/c1-9-8-19-6-4-11-12(9)20-13(10-2-3-10)21-14(11)22-7-5-15(16,17)18;;/h9-10,19H,2-8H2,1H3;2*1H |
| InChIKey | BINYSTNJCGNDAQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |