C22H28O4S — CID 11581857
(3S,4R,5R)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1lambda6-benzothiepine-4,8-diol (PubChem CID 11581857) has the molecular formula C22H28O4S and a molecular weight of 388.53 g/mol. Its IUPAC name is (3S,4R,5R)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1lambda6-benzothiepine-4,8-diol.
| Compound Name | (3S,4R,5R)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1lambda6-benzothiepine-4,8-diol |
|---|---|
| PubChem CID | 11581857 |
| Molecular Formula | C22H28O4S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (3S,4R,5R)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1lambda6-benzothiepine-4,8-diol |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2cc(O)ccc2[C@@H](c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C22H28O4S/c1-3-5-13-22(4-2)15-27(25,26)19-14-17(23)11-12-18(19)20(21(22)24)16-9-7-6-8-10-16/h6-12,14,20-21,23-24H,3-5,13,15H2,1-2H3/t20-,21-,22-/m1/s1 |
| InChIKey | HKOMRBZBGBHSFR-YPAWHYETSA-N |
| XLogP | 4.26 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |