C13H16F6N2O5 — CID 11581962
ethyl 4-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]butanoate (PubChem CID 11581962) has the molecular formula C13H16F6N2O5 and a molecular weight of 394.27 g/mol. Its IUPAC name is ethyl 4-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]butanoate.
| Compound Name | ethyl 4-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 11581962 |
| Molecular Formula | C13H16F6N2O5 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | ethyl 4-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)C1=NOC(C(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C13H16F6N2O5/c1-2-25-9(22)4-3-5-20-10(23)7-6-8(26-21-7)11(24,12(14,15)16)13(17,18)19/h8,24H,2-6H2,1H3,(H,20,23) |
| InChIKey | FFXBBOOFHBEWHR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|