About tert-butyl N-[3-(2-hydroxy-2,2-diphenylethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate
tert-butyl N-[3-(2-hydroxy-2,2-diphenylethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate (PubChem CID 11581988) has the molecular formula C24H30N2O3
and a molecular weight of 394.52 g/mol. Its IUPAC name is tert-butyl N-[3-(2-hydroxy-2,2-diphenylethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[3-(2-hydroxy-2,2-diphenylethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate |
| PubChem CID | 11581988 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | tert-butyl N-[3-(2-hydroxy-2,2-diphenylethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1C2CN(CC(O)(c3ccccc3)c3ccccc3)CC21 |
| InChI | InChI=1S/C24H30N2O3/c1-23(2,3)29-22(27)25-21-19-14-26(15-20(19)21)16-24(28,17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,19-21,28H,14-16H2,1-3H3,(H,25,27) |
| InChIKey | QQJIGMOVBNFLFX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[3-(2-hydroxy-2,2-diphenylethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[3-(2-hydroxy-2,2-diphenylethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate?
The IUPAC name of tert-butyl N-[3-(2-hydroxy-2,2-diphenylethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate (CID 11581988) is tert-butyl N-[3-(2-hydroxy-2,2-diphenylethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate.
What is the SMILES notation for tert-butyl N-[3-(2-hydroxy-2,2-diphenylethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate?
The canonical SMILES for tert-butyl N-[3-(2-hydroxy-2,2-diphenylethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate is CC(C)(C)OC(=O)NC1C2CN(CC(O)(c3ccccc3)c3ccccc3)CC21.
What is the InChIKey of tert-butyl N-[3-(2-hydroxy-2,2-diphenylethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate?
The InChIKey is QQJIGMOVBNFLFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N2O3/c1-23(2,3)29-22(27)25-21-19-14-26(15-20(19)21)16-24(28,17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,19-21,28H,14-16H2,1-3H3,(H,25,27).
What are the key properties of tert-butyl N-[3-(2-hydroxy-2,2-diphenylethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate?
tert-butyl N-[3-(2-hydroxy-2,2-diphenylethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate has a molecular weight of 394.52 g/mol, XLogP of 3.38, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[3-(2-hydroxy-2,2-diphenylethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate is sourced from PubChem (CID 11581988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).