C14H16O4S — CID 115821638
(3,5-dimethoxyphenyl)-(4-methoxythiophen-2-yl)methanol (PubChem CID 115821638) has the molecular formula C14H16O4S and a molecular weight of 280.35 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-(4-methoxythiophen-2-yl)methanol.
| Compound Name | (3,5-dimethoxyphenyl)-(4-methoxythiophen-2-yl)methanol |
|---|---|
| PubChem CID | 115821638 |
| Molecular Formula | C14H16O4S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (3,5-dimethoxyphenyl)-(4-methoxythiophen-2-yl)methanol |
| SMILES | COc1cc(OC)cc(C(O)c2cc(OC)cs2)c1 |
| InChI | InChI=1S/C14H16O4S/c1-16-10-4-9(5-11(6-10)17-2)14(15)13-7-12(18-3)8-19-13/h4-8,14-15H,1-3H3 |
| InChIKey | YHPSJIPFCSXRSH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |